C6H4Cl2F2N2O2S — CID 130103054
6-amino-5-chloro-3-(difluoromethyl)pyridine-2-sulfonyl chloride (PubChem CID 130103054) has the molecular formula C6H4Cl2F2N2O2S and a molecular weight of 277.08 g/mol. Its IUPAC name is 6-amino-5-chloro-3-(difluoromethyl)pyridine-2-sulfonyl chloride.
| Compound Name | 6-amino-5-chloro-3-(difluoromethyl)pyridine-2-sulfonyl chloride |
|---|---|
| PubChem CID | 130103054 |
| Molecular Formula | C6H4Cl2F2N2O2S |
| Molecular Weight | 277.08 g/mol |
| Exact Mass | 275.93 |
| IUPAC Name | 6-amino-5-chloro-3-(difluoromethyl)pyridine-2-sulfonyl chloride |
| SMILES | Nc1nc(S(=O)(=O)Cl)c(C(F)F)cc1Cl |
| InChI | InChI=1S/C6H4Cl2F2N2O2S/c7-3-1-2(4(9)10)6(12-5(3)11)15(8,13)14/h1,4H,(H2,11,12) |
| InChIKey | FZONDFSDXGATFU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.08 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |