C8H8F2N4 — CID 130103400
5-amino-3-(aminomethyl)-4-(difluoromethyl)pyridine-2-carbonitrile (PubChem CID 130103400) has the molecular formula C8H8F2N4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 5-amino-3-(aminomethyl)-4-(difluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 5-amino-3-(aminomethyl)-4-(difluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 130103400 |
| Molecular Formula | C8H8F2N4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 5-amino-3-(aminomethyl)-4-(difluoromethyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ncc(N)c(C(F)F)c1CN |
| InChI | InChI=1S/C8H8F2N4/c9-8(10)7-4(1-11)6(2-12)14-3-5(7)13/h3,8H,1,11,13H2 |
| InChIKey | SOFMIBYXRVGXMI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |