C9H6F2N4 — CID 130103555
4-amino-5-(cyanomethyl)-2-(difluoromethyl)pyridine-3-carbonitrile (PubChem CID 130103555) has the molecular formula C9H6F2N4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 4-amino-5-(cyanomethyl)-2-(difluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 4-amino-5-(cyanomethyl)-2-(difluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 130103555 |
| Molecular Formula | C9H6F2N4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 4-amino-5-(cyanomethyl)-2-(difluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#CCc1cnc(C(F)F)c(C#N)c1N |
| InChI | InChI=1S/C9H6F2N4/c10-9(11)8-6(3-13)7(14)5(1-2-12)4-15-8/h4,9H,1H2,(H2,14,15) |
| InChIKey | RHYSVCWWDVLYGX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |