C9H10F2N2O2 — CID 130106595
methyl 2-amino-5-(difluoromethyl)-4-methylpyridine-3-carboxylate (PubChem CID 130106595) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is methyl 2-amino-5-(difluoromethyl)-4-methylpyridine-3-carboxylate.
| Compound Name | methyl 2-amino-5-(difluoromethyl)-4-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 130106595 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | methyl 2-amino-5-(difluoromethyl)-4-methylpyridine-3-carboxylate |
| SMILES | COC(=O)c1c(N)ncc(C(F)F)c1C |
| InChI | InChI=1S/C9H10F2N2O2/c1-4-5(7(10)11)3-13-8(12)6(4)9(14)15-2/h3,7H,1-2H3,(H2,12,13) |
| InChIKey | BUGVTQAWAXAJHI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |