C7H9F2N3O2S — CID 130106746
6-amino-2-(difluoromethyl)-4-methylpyridine-3-sulfonamide (PubChem CID 130106746) has the molecular formula C7H9F2N3O2S and a molecular weight of 237.23 g/mol. Its IUPAC name is 6-amino-2-(difluoromethyl)-4-methylpyridine-3-sulfonamide.
| Compound Name | 6-amino-2-(difluoromethyl)-4-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 130106746 |
| Molecular Formula | C7H9F2N3O2S |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 6-amino-2-(difluoromethyl)-4-methylpyridine-3-sulfonamide |
| SMILES | Cc1cc(N)nc(C(F)F)c1S(N)(=O)=O |
| InChI | InChI=1S/C7H9F2N3O2S/c1-3-2-4(10)12-5(7(8)9)6(3)15(11,13)14/h2,7H,1H3,(H2,10,12)(H2,11,13,14) |
| InChIKey | QYQFMMPNCCEBTN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |