C8H9BrF2N2O — CID 130107153
[6-amino-4-(bromomethyl)-2-(difluoromethyl)-3-pyridinyl]methanol (PubChem CID 130107153) has the molecular formula C8H9BrF2N2O and a molecular weight of 267.07 g/mol. Its IUPAC name is [6-amino-4-(bromomethyl)-2-(difluoromethyl)-3-pyridinyl]methanol.
| Compound Name | [6-amino-4-(bromomethyl)-2-(difluoromethyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 130107153 |
| Molecular Formula | C8H9BrF2N2O |
| Molecular Weight | 267.07 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | [6-amino-4-(bromomethyl)-2-(difluoromethyl)-3-pyridinyl]methanol |
| SMILES | Nc1cc(CBr)c(CO)c(C(F)F)n1 |
| InChI | InChI=1S/C8H9BrF2N2O/c9-2-4-1-6(12)13-7(8(10)11)5(4)3-14/h1,8,14H,2-3H2,(H2,12,13) |
| InChIKey | DQWLAHCRSJPCSI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.07 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|