2-prop-2-enylhexanoic acid

C9H16O2 — CID 13010742

IUPAC2-prop-2-enylhexanoic acid
SMILESC=CCC(CCCC)C(=O)O
InChIInChI=1S/C9H16O2/c1-3-5-7-8(6-4-2)9(10)11/h4,8H,2-3,5-7H2,1H3,(H,10,11)
InChIKeyPXULVNRQCVINOV-UHFFFAOYSA-N
MW156.22 g/mol
LogP2.45
Rot. Bonds6

About 2-prop-2-enylhexanoic acid

2-prop-2-enylhexanoic acid (PubChem CID 13010742) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 2-prop-2-enylhexanoic acid.

Molecular Properties

Compound Name2-prop-2-enylhexanoic acid
PubChem CID13010742
Molecular FormulaC9H16O2
Molecular Weight156.22 g/mol
Exact Mass156.12
IUPAC Name2-prop-2-enylhexanoic acid
SMILESC=CCC(CCCC)C(=O)O
InChIInChI=1S/C9H16O2/c1-3-5-7-8(6-4-2)9(10)11/h4,8H,2-3,5-7H2,1H3,(H,10,11)
InChIKeyPXULVNRQCVINOV-UHFFFAOYSA-N
XLogP2.45
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.22
LogP ≤ 52.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-prop-2-enylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-prop-2-enylhexanoic acid?
The IUPAC name of 2-prop-2-enylhexanoic acid (CID 13010742) is 2-prop-2-enylhexanoic acid.
What is the SMILES notation for 2-prop-2-enylhexanoic acid?
The canonical SMILES for 2-prop-2-enylhexanoic acid is C=CCC(CCCC)C(=O)O.
What is the InChIKey of 2-prop-2-enylhexanoic acid?
The InChIKey is PXULVNRQCVINOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-3-5-7-8(6-4-2)9(10)11/h4,8H,2-3,5-7H2,1H3,(H,10,11).
What are the key properties of 2-prop-2-enylhexanoic acid?
2-prop-2-enylhexanoic acid has a molecular weight of 156.22 g/mol, XLogP of 2.45, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylhexanoic acid is sourced from PubChem (CID 13010742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).