About 2-prop-2-enylheptanoic acid
2-prop-2-enylheptanoic acid (PubChem CID 13010746) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-prop-2-enylheptanoic acid.
Molecular Properties
| Compound Name | 2-prop-2-enylheptanoic acid |
| PubChem CID | 13010746 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2-prop-2-enylheptanoic acid |
| SMILES | C=CCC(CCCCC)C(=O)O |
| InChI | InChI=1S/C10H18O2/c1-3-5-6-8-9(7-4-2)10(11)12/h4,9H,2-3,5-8H2,1H3,(H,11,12) |
| InChIKey | QAIVQQGFMWYZCC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylheptanoic acid?
The IUPAC name of 2-prop-2-enylheptanoic acid (CID 13010746) is 2-prop-2-enylheptanoic acid.
What is the SMILES notation for 2-prop-2-enylheptanoic acid?
The canonical SMILES for 2-prop-2-enylheptanoic acid is C=CCC(CCCCC)C(=O)O.
What is the InChIKey of 2-prop-2-enylheptanoic acid?
The InChIKey is QAIVQQGFMWYZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-3-5-6-8-9(7-4-2)10(11)12/h4,9H,2-3,5-8H2,1H3,(H,11,12).
What are the key properties of 2-prop-2-enylheptanoic acid?
2-prop-2-enylheptanoic acid has a molecular weight of 170.25 g/mol, XLogP of 2.84, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylheptanoic acid is sourced from PubChem (CID 13010746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).