2-prop-2-enylheptanoic acid

C10H18O2 — CID 13010746

IUPAC2-prop-2-enylheptanoic acid
SMILESC=CCC(CCCCC)C(=O)O
InChIInChI=1S/C10H18O2/c1-3-5-6-8-9(7-4-2)10(11)12/h4,9H,2-3,5-8H2,1H3,(H,11,12)
InChIKeyQAIVQQGFMWYZCC-UHFFFAOYSA-N
MW170.25 g/mol
LogP2.84
Rot. Bonds7

About 2-prop-2-enylheptanoic acid

2-prop-2-enylheptanoic acid (PubChem CID 13010746) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-prop-2-enylheptanoic acid.

Molecular Properties

Compound Name2-prop-2-enylheptanoic acid
PubChem CID13010746
Molecular FormulaC10H18O2
Molecular Weight170.25 g/mol
Exact Mass170.13
IUPAC Name2-prop-2-enylheptanoic acid
SMILESC=CCC(CCCCC)C(=O)O
InChIInChI=1S/C10H18O2/c1-3-5-6-8-9(7-4-2)10(11)12/h4,9H,2-3,5-8H2,1H3,(H,11,12)
InChIKeyQAIVQQGFMWYZCC-UHFFFAOYSA-N
XLogP2.84
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds7
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.25
LogP ≤ 52.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-prop-2-enylheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-prop-2-enylheptanoic acid?
The IUPAC name of 2-prop-2-enylheptanoic acid (CID 13010746) is 2-prop-2-enylheptanoic acid.
What is the SMILES notation for 2-prop-2-enylheptanoic acid?
The canonical SMILES for 2-prop-2-enylheptanoic acid is C=CCC(CCCCC)C(=O)O.
What is the InChIKey of 2-prop-2-enylheptanoic acid?
The InChIKey is QAIVQQGFMWYZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-3-5-6-8-9(7-4-2)10(11)12/h4,9H,2-3,5-8H2,1H3,(H,11,12).
What are the key properties of 2-prop-2-enylheptanoic acid?
2-prop-2-enylheptanoic acid has a molecular weight of 170.25 g/mol, XLogP of 2.84, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylheptanoic acid is sourced from PubChem (CID 13010746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).