C8H7F4NO2 — CID 130111993
6-(fluoromethyl)-4-methyl-5-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 130111993) has the molecular formula C8H7F4NO2 and a molecular weight of 225.14 g/mol. Its IUPAC name is 6-(fluoromethyl)-4-methyl-5-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 6-(fluoromethyl)-4-methyl-5-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130111993 |
| Molecular Formula | C8H7F4NO2 |
| Molecular Weight | 225.14 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 6-(fluoromethyl)-4-methyl-5-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | Cc1cc(=O)[nH]c(CF)c1OC(F)(F)F |
| InChI | InChI=1S/C8H7F4NO2/c1-4-2-6(14)13-5(3-9)7(4)15-8(10,11)12/h2H,3H2,1H3,(H,13,14) |
| InChIKey | FNCQGIIHWRATHP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.14 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |