[2-(2-bromophenyl)phenyl]boronic acid

C12H10BBrO2 — CID 130113640

IUPAC[2-(2-bromophenyl)phenyl]boronic acid
SMILESOB(O)c1ccccc1-c1ccccc1Br
InChIInChI=1S/C12H10BBrO2/c14-12-8-4-2-6-10(12)9-5-1-3-7-11(9)13(15)16/h1-8,15-16H
InChIKeyBXYVFENPSFGAIM-UHFFFAOYSA-N
MW276.93 g/mol
LogP1.80
Rot. Bonds2

About [2-(2-bromophenyl)phenyl]boronic acid

[2-(2-bromophenyl)phenyl]boronic acid (PubChem CID 130113640) has the molecular formula C12H10BBrO2 and a molecular weight of 276.93 g/mol. Its IUPAC name is [2-(2-bromophenyl)phenyl]boronic acid.

Molecular Properties

Compound Name[2-(2-bromophenyl)phenyl]boronic acid
PubChem CID130113640
Molecular FormulaC12H10BBrO2
Molecular Weight276.93 g/mol
Exact Mass276.00
IUPAC Name[2-(2-bromophenyl)phenyl]boronic acid
SMILESOB(O)c1ccccc1-c1ccccc1Br
InChIInChI=1S/C12H10BBrO2/c14-12-8-4-2-6-10(12)9-5-1-3-7-11(9)13(15)16/h1-8,15-16H
InChIKeyBXYVFENPSFGAIM-UHFFFAOYSA-N
XLogP1.80
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.93
LogP ≤ 51.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2-(2-bromophenyl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2-bromophenyl)phenyl]boronic acid?
The IUPAC name of [2-(2-bromophenyl)phenyl]boronic acid (CID 130113640) is [2-(2-bromophenyl)phenyl]boronic acid.
What is the SMILES notation for [2-(2-bromophenyl)phenyl]boronic acid?
The canonical SMILES for [2-(2-bromophenyl)phenyl]boronic acid is OB(O)c1ccccc1-c1ccccc1Br.
What is the InChIKey of [2-(2-bromophenyl)phenyl]boronic acid?
The InChIKey is BXYVFENPSFGAIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BBrO2/c14-12-8-4-2-6-10(12)9-5-1-3-7-11(9)13(15)16/h1-8,15-16H.
What are the key properties of [2-(2-bromophenyl)phenyl]boronic acid?
[2-(2-bromophenyl)phenyl]boronic acid has a molecular weight of 276.93 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-bromophenyl)phenyl]boronic acid is sourced from PubChem (CID 130113640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).