About 3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol
3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 130114095) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is 3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 130114095 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | O=[N+]([O-])CC1CC(O)c2ccccc21 |
| InChI | InChI=1S/C10H11NO3/c12-10-5-7(6-11(13)14)8-3-1-2-4-9(8)10/h1-4,7,10,12H,5-6H2 |
| InChIKey | DCLDXXUFXBGUQQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol (CID 130114095) is 3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol is O=[N+]([O-])CC1CC(O)c2ccccc21.
What is the InChIKey of 3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol?
The InChIKey is DCLDXXUFXBGUQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c12-10-5-7(6-11(13)14)8-3-1-2-4-9(8)10/h1-4,7,10,12H,5-6H2.
What are the key properties of 3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol?
3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol has a molecular weight of 193.20 g/mol, XLogP of 1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(nitromethyl)-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 130114095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).