C14H21BBrNO3 — CID 130114420
3-bromo-2-propoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 130114420) has the molecular formula C14H21BBrNO3 and a molecular weight of 342.04 g/mol. Its IUPAC name is 3-bromo-2-propoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-bromo-2-propoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 130114420 |
| Molecular Formula | C14H21BBrNO3 |
| Molecular Weight | 342.04 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 3-bromo-2-propoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CCCOc1ncc(B2OC(C)(C)C(C)(C)O2)cc1Br |
| InChI | InChI=1S/C14H21BBrNO3/c1-6-7-18-12-11(16)8-10(9-17-12)15-19-13(2,3)14(4,5)20-15/h8-9H,6-7H2,1-5H3 |
| InChIKey | QMPLCSLALOVANX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.04 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|