C12H21FN2O3 — CID 130114757
tert-butyl 8-fluoro-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine-6-carboxylate (PubChem CID 130114757) has the molecular formula C12H21FN2O3 and a molecular weight of 260.31 g/mol. Its IUPAC name is tert-butyl 8-fluoro-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine-6-carboxylate.
| Compound Name | tert-butyl 8-fluoro-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine-6-carboxylate |
|---|---|
| PubChem CID | 130114757 |
| Molecular Formula | C12H21FN2O3 |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | tert-butyl 8-fluoro-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)C2OCCNC2C1 |
| InChI | InChI=1S/C12H21FN2O3/c1-12(2,3)18-11(16)15-6-8(13)10-9(7-15)14-4-5-17-10/h8-10,14H,4-7H2,1-3H3 |
| InChIKey | ZPJVVASQWIRGCF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |