About 4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine
4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine (PubChem CID 130114979) has the molecular formula C7H6BrN3S
and a molecular weight of 244.12 g/mol. Its IUPAC name is 4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine.
Molecular Properties
| Compound Name | 4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine |
| PubChem CID | 130114979 |
| Molecular Formula | C7H6BrN3S |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | 4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine |
| SMILES | CSc1nc(Br)c2cccn2n1 |
| InChI | InChI=1S/C7H6BrN3S/c1-12-7-9-6(8)5-3-2-4-11(5)10-7/h2-4H,1H3 |
| InChIKey | NFDXYSLOIFNBKI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine?
The IUPAC name of 4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine (CID 130114979) is 4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine.
What is the SMILES notation for 4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine?
The canonical SMILES for 4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine is CSc1nc(Br)c2cccn2n1.
What is the InChIKey of 4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine?
The InChIKey is NFDXYSLOIFNBKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3S/c1-12-7-9-6(8)5-3-2-4-11(5)10-7/h2-4H,1H3.
What are the key properties of 4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine?
4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine has a molecular weight of 244.12 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine is sourced from PubChem (CID 130114979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).