C5H7IN4 — CID 130114995
3-iodo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine (PubChem CID 130114995) has the molecular formula C5H7IN4 and a molecular weight of 250.04 g/mol. Its IUPAC name is 3-iodo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine.
| Compound Name | 3-iodo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 130114995 |
| Molecular Formula | C5H7IN4 |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 3-iodo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine |
| SMILES | Ic1nnn2c1CNCC2 |
| InChI | InChI=1S/C5H7IN4/c6-5-4-3-7-1-2-10(4)9-8-5/h7H,1-3H2 |
| InChIKey | CCNHXVTYGIHPQB-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|