About 4-methylpyrazolo[5,1-c][1,2,4]triazine
4-methylpyrazolo[5,1-c][1,2,4]triazine (PubChem CID 13011562) has the molecular formula C6H6N4
and a molecular weight of 134.14 g/mol. Its IUPAC name is 4-methylpyrazolo[5,1-c][1,2,4]triazine.
Molecular Properties
| Compound Name | 4-methylpyrazolo[5,1-c][1,2,4]triazine |
| PubChem CID | 13011562 |
| Molecular Formula | C6H6N4 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 4-methylpyrazolo[5,1-c][1,2,4]triazine |
| SMILES | Cc1cnnc2ccnn12 |
| InChI | InChI=1S/C6H6N4/c1-5-4-7-9-6-2-3-8-10(5)6/h2-4H,1H3 |
| InChIKey | BXJBYOQBZNKQCH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methylpyrazolo[5,1-c][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpyrazolo[5,1-c][1,2,4]triazine?
The IUPAC name of 4-methylpyrazolo[5,1-c][1,2,4]triazine (CID 13011562) is 4-methylpyrazolo[5,1-c][1,2,4]triazine.
What is the SMILES notation for 4-methylpyrazolo[5,1-c][1,2,4]triazine?
The canonical SMILES for 4-methylpyrazolo[5,1-c][1,2,4]triazine is Cc1cnnc2ccnn12.
What is the InChIKey of 4-methylpyrazolo[5,1-c][1,2,4]triazine?
The InChIKey is BXJBYOQBZNKQCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4/c1-5-4-7-9-6-2-3-8-10(5)6/h2-4H,1H3.
What are the key properties of 4-methylpyrazolo[5,1-c][1,2,4]triazine?
4-methylpyrazolo[5,1-c][1,2,4]triazine has a molecular weight of 134.14 g/mol, XLogP of 0.43, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpyrazolo[5,1-c][1,2,4]triazine is sourced from PubChem (CID 13011562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).