About 8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine
8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine (PubChem CID 13011565) has the molecular formula C6H5BrN4
and a molecular weight of 213.04 g/mol. Its IUPAC name is 8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine.
Molecular Properties
| Compound Name | 8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine |
| PubChem CID | 13011565 |
| Molecular Formula | C6H5BrN4 |
| Molecular Weight | 213.04 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | 8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine |
| SMILES | Cc1cnnc2c(Br)cnn12 |
| InChI | InChI=1S/C6H5BrN4/c1-4-2-8-10-6-5(7)3-9-11(4)6/h2-3H,1H3 |
| InChIKey | ZVCPMOKCTUXKRX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.04 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine?
The IUPAC name of 8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine (CID 13011565) is 8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine.
What is the SMILES notation for 8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine?
The canonical SMILES for 8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine is Cc1cnnc2c(Br)cnn12.
What is the InChIKey of 8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine?
The InChIKey is ZVCPMOKCTUXKRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrN4/c1-4-2-8-10-6-5(7)3-9-11(4)6/h2-3H,1H3.
What are the key properties of 8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine?
8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine has a molecular weight of 213.04 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-4-methylpyrazolo[5,1-c][1,2,4]triazine is sourced from PubChem (CID 13011565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).