About 2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane
2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane (PubChem CID 13011749) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is 2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane.
Molecular Properties
| Compound Name | 2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane |
| PubChem CID | 13011749 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane |
| SMILES | C=C=C(OC)C1(C)CO1 |
| InChI | InChI=1S/C7H10O2/c1-4-6(8-3)7(2)5-9-7/h1,5H2,2-3H3 |
| InChIKey | GAEQYZLANLWHCP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane?
The IUPAC name of 2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane (CID 13011749) is 2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane.
What is the SMILES notation for 2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane?
The canonical SMILES for 2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane is C=C=C(OC)C1(C)CO1.
What is the InChIKey of 2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane?
The InChIKey is GAEQYZLANLWHCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-4-6(8-3)7(2)5-9-7/h1,5H2,2-3H3.
What are the key properties of 2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane?
2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane has a molecular weight of 126.15 g/mol, XLogP of 1.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methoxypropa-1,2-dienyl)-2-methyloxirane is sourced from PubChem (CID 13011749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).