C10H15ClN2S — CID 130117727
7-(5-chlorothiophen-2-yl)-1-methyl-1,4-diazepane (PubChem CID 130117727) has the molecular formula C10H15ClN2S and a molecular weight of 230.76 g/mol. Its IUPAC name is 7-(5-chlorothiophen-2-yl)-1-methyl-1,4-diazepane.
| Compound Name | 7-(5-chlorothiophen-2-yl)-1-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 130117727 |
| Molecular Formula | C10H15ClN2S |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 7-(5-chlorothiophen-2-yl)-1-methyl-1,4-diazepane |
| SMILES | CN1CCNCCC1c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H15ClN2S/c1-13-7-6-12-5-4-8(13)9-2-3-10(11)14-9/h2-3,8,12H,4-7H2,1H3 |
| InChIKey | NHNDPGUNKGXPIJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |