C18H24ClN — CID 13011907
2-phenyl-N-(3-phenylpropyl)propan-1-amine;hydrochloride (PubChem CID 13011907) has the molecular formula C18H24ClN and a molecular weight of 289.85 g/mol. Its IUPAC name is 2-phenyl-N-(3-phenylpropyl)propan-1-amine;hydrochloride.
| Compound Name | 2-phenyl-N-(3-phenylpropyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 13011907 |
| Molecular Formula | C18H24ClN |
| Molecular Weight | 289.85 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-phenyl-N-(3-phenylpropyl)propan-1-amine;hydrochloride |
| SMILES | CC(CNCCCc1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C18H23N.ClH/c1-16(18-12-6-3-7-13-18)15-19-14-8-11-17-9-4-2-5-10-17;/h2-7,9-10,12-13,16,19H,8,11,14-15H2,1H3;1H |
| InChIKey | AYPJLMAEMLXWRS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.85 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|