C8H11N3 — CID 130119178
5,6,7,8-tetrahydro-1,5-naphthyridin-2-amine (PubChem CID 130119178) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-1,5-naphthyridin-2-amine.
| Compound Name | 5,6,7,8-tetrahydro-1,5-naphthyridin-2-amine |
|---|---|
| PubChem CID | 130119178 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 5,6,7,8-tetrahydro-1,5-naphthyridin-2-amine |
| SMILES | Nc1ccc2c(n1)CCCN2 |
| InChI | InChI=1S/C8H11N3/c9-8-4-3-6-7(11-8)2-1-5-10-6/h3-4,10H,1-2,5H2,(H2,9,11) |
| InChIKey | CMEXATFKZQGGHY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |