About N,N'-diphenylbutane-1,4-diamine
N,N'-diphenylbutane-1,4-diamine (PubChem CID 13011971) has the molecular formula C16H20N2
and a molecular weight of 240.35 g/mol. Its IUPAC name is N,N'-diphenylbutane-1,4-diamine.
Molecular Properties
| Compound Name | N,N'-diphenylbutane-1,4-diamine |
| PubChem CID | 13011971 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N,N'-diphenylbutane-1,4-diamine |
| SMILES | c1ccc(NCCCCNc2ccccc2)cc1 |
| InChI | InChI=1S/C16H20N2/c1-3-9-15(10-4-1)17-13-7-8-14-18-16-11-5-2-6-12-16/h1-6,9-12,17-18H,7-8,13-14H2 |
| InChIKey | IWGFOKDKNXXIRB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-diphenylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-diphenylbutane-1,4-diamine?
The IUPAC name of N,N'-diphenylbutane-1,4-diamine (CID 13011971) is N,N'-diphenylbutane-1,4-diamine.
What is the SMILES notation for N,N'-diphenylbutane-1,4-diamine?
The canonical SMILES for N,N'-diphenylbutane-1,4-diamine is c1ccc(NCCCCNc2ccccc2)cc1.
What is the InChIKey of N,N'-diphenylbutane-1,4-diamine?
The InChIKey is IWGFOKDKNXXIRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2/c1-3-9-15(10-4-1)17-13-7-8-14-18-16-11-5-2-6-12-16/h1-6,9-12,17-18H,7-8,13-14H2.
What are the key properties of N,N'-diphenylbutane-1,4-diamine?
N,N'-diphenylbutane-1,4-diamine has a molecular weight of 240.35 g/mol, XLogP of 3.99, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-diphenylbutane-1,4-diamine is sourced from PubChem (CID 13011971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).