C8H5F3N2O — CID 130119816
4-(trifluoromethoxy)-1H-pyrrolo[3,2-c]pyridine (PubChem CID 130119816) has the molecular formula C8H5F3N2O and a molecular weight of 202.14 g/mol. Its IUPAC name is 4-(trifluoromethoxy)-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 4-(trifluoromethoxy)-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 130119816 |
| Molecular Formula | C8H5F3N2O |
| Molecular Weight | 202.14 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 4-(trifluoromethoxy)-1H-pyrrolo[3,2-c]pyridine |
| SMILES | FC(F)(F)Oc1nccc2[nH]ccc12 |
| InChI | InChI=1S/C8H5F3N2O/c9-8(10,11)14-7-5-1-3-12-6(5)2-4-13-7/h1-4,12H |
| InChIKey | QRLAZLODLDAESL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.14 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |