C11H12S2 — CID 13012010
2-cyclohepta-2,4,6-trien-1-ylidene-1,3-dithiane (PubChem CID 13012010) has the molecular formula C11H12S2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 2-cyclohepta-2,4,6-trien-1-ylidene-1,3-dithiane.
| Compound Name | 2-cyclohepta-2,4,6-trien-1-ylidene-1,3-dithiane |
|---|---|
| PubChem CID | 13012010 |
| Molecular Formula | C11H12S2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 2-cyclohepta-2,4,6-trien-1-ylidene-1,3-dithiane |
| SMILES | C1=CC=CC(=C2SCCCS2)C=C1 |
| InChI | InChI=1S/C11H12S2/c1-2-4-7-10(6-3-1)11-12-8-5-9-13-11/h1-4,6-7H,5,8-9H2 |
| InChIKey | UIORUBIKQBOICP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |