C11H14S2 — CID 13012012
2-cyclohepta-2,4,6-trien-1-yl-1,3-dithiane (PubChem CID 13012012) has the molecular formula C11H14S2 and a molecular weight of 210.37 g/mol. Its IUPAC name is 2-cyclohepta-2,4,6-trien-1-yl-1,3-dithiane.
| Compound Name | 2-cyclohepta-2,4,6-trien-1-yl-1,3-dithiane |
|---|---|
| PubChem CID | 13012012 |
| Molecular Formula | C11H14S2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-cyclohepta-2,4,6-trien-1-yl-1,3-dithiane |
| SMILES | C1=CC=CC(C2SCCCS2)C=C1 |
| InChI | InChI=1S/C11H14S2/c1-2-4-7-10(6-3-1)11-12-8-5-9-13-11/h1-4,6-7,10-11H,5,8-9H2 |
| InChIKey | LWSBWWAAYCMQBA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |