About 4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine
4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 130121035) has the molecular formula C8H7IN2
and a molecular weight of 258.06 g/mol. Its IUPAC name is 4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 130121035 |
| Molecular Formula | C8H7IN2 |
| Molecular Weight | 258.06 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Cc1cc2c(I)ccnc2[nH]1 |
| InChI | InChI=1S/C8H7IN2/c1-5-4-6-7(9)2-3-10-8(6)11-5/h2-4H,1H3,(H,10,11) |
| InChIKey | XCDMOTUEROOHIY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.06 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine (CID 130121035) is 4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine is Cc1cc2c(I)ccnc2[nH]1.
What is the InChIKey of 4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is XCDMOTUEROOHIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IN2/c1-5-4-6-7(9)2-3-10-8(6)11-5/h2-4H,1H3,(H,10,11).
What are the key properties of 4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine?
4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 258.06 g/mol, XLogP of 2.48, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 130121035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).