About 1-(4-bromo-2,6-difluorophenyl)pyrazole
1-(4-bromo-2,6-difluorophenyl)pyrazole (PubChem CID 130121393) has the molecular formula C9H5BrF2N2
and a molecular weight of 259.05 g/mol. Its IUPAC name is 1-(4-bromo-2,6-difluorophenyl)pyrazole.
Molecular Properties
| Compound Name | 1-(4-bromo-2,6-difluorophenyl)pyrazole |
| PubChem CID | 130121393 |
| Molecular Formula | C9H5BrF2N2 |
| Molecular Weight | 259.05 g/mol |
| Exact Mass | 257.96 |
| IUPAC Name | 1-(4-bromo-2,6-difluorophenyl)pyrazole |
| SMILES | Fc1cc(Br)cc(F)c1-n1cccn1 |
| InChI | InChI=1S/C9H5BrF2N2/c10-6-4-7(11)9(8(12)5-6)14-3-1-2-13-14/h1-5H |
| InChIKey | BWSIEZDKDDIUNM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.05 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-bromo-2,6-difluorophenyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-2,6-difluorophenyl)pyrazole?
The IUPAC name of 1-(4-bromo-2,6-difluorophenyl)pyrazole (CID 130121393) is 1-(4-bromo-2,6-difluorophenyl)pyrazole.
What is the SMILES notation for 1-(4-bromo-2,6-difluorophenyl)pyrazole?
The canonical SMILES for 1-(4-bromo-2,6-difluorophenyl)pyrazole is Fc1cc(Br)cc(F)c1-n1cccn1.
What is the InChIKey of 1-(4-bromo-2,6-difluorophenyl)pyrazole?
The InChIKey is BWSIEZDKDDIUNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrF2N2/c10-6-4-7(11)9(8(12)5-6)14-3-1-2-13-14/h1-5H.
What are the key properties of 1-(4-bromo-2,6-difluorophenyl)pyrazole?
1-(4-bromo-2,6-difluorophenyl)pyrazole has a molecular weight of 259.05 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-2,6-difluorophenyl)pyrazole is sourced from PubChem (CID 130121393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).