About 1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride
1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride (PubChem CID 13012143) has the molecular formula C21H29ClN2O
and a molecular weight of 360.93 g/mol. Its IUPAC name is 1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride |
| PubChem CID | 13012143 |
| Molecular Formula | C21H29ClN2O |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride |
| SMILES | CC(/N=C1/CCCN1C)c1ccc(CCc2ccccc2)cc1.Cl.O |
| InChI | InChI=1S/C21H26N2.ClH.H2O/c1-17(22-21-9-6-16-23(21)2)20-14-12-19(13-15-20)11-10-18-7-4-3-5-8-18;;/h3-5,7-8,12-15,17H,6,9-11,16H2,1-2H3;1H;1H2/b22-21-;; |
| InChIKey | OTIQFDWQFPQFRC-RKFQPGFBSA-N |
| XLogP | 4.25 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride?
The IUPAC name of 1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride (CID 13012143) is 1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride.
What is the SMILES notation for 1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride?
The canonical SMILES for 1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride is CC(/N=C1/CCCN1C)c1ccc(CCc2ccccc2)cc1.Cl.O.
What is the InChIKey of 1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride?
The InChIKey is OTIQFDWQFPQFRC-RKFQPGFBSA-N. The full InChI is InChI=1S/C21H26N2.ClH.H2O/c1-17(22-21-9-6-16-23(21)2)20-14-12-19(13-15-20)11-10-18-7-4-3-5-8-18;;/h3-5,7-8,12-15,17H,6,9-11,16H2,1-2H3;1H;1H2/b22-21-;;.
What are the key properties of 1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride?
1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride has a molecular weight of 360.93 g/mol, XLogP of 4.25, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[1-[4-(2-phenylethyl)phenyl]ethyl]pyrrolidin-2-imine;hydrate;hydrochloride is sourced from PubChem (CID 13012143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).