About 4-hydroxy-3-methyl-1,3-thiazolidine-2-thione
4-hydroxy-3-methyl-1,3-thiazolidine-2-thione (PubChem CID 130122041) has the molecular formula C4H7NOS2
and a molecular weight of 149.24 g/mol. Its IUPAC name is 4-hydroxy-3-methyl-1,3-thiazolidine-2-thione.
Molecular Properties
| Compound Name | 4-hydroxy-3-methyl-1,3-thiazolidine-2-thione |
| PubChem CID | 130122041 |
| Molecular Formula | C4H7NOS2 |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.00 |
| IUPAC Name | 4-hydroxy-3-methyl-1,3-thiazolidine-2-thione |
| SMILES | CN1C(=S)SCC1O |
| InChI | InChI=1S/C4H7NOS2/c1-5-3(6)2-8-4(5)7/h3,6H,2H2,1H3 |
| InChIKey | LBRPRFBIIKBDEN-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-methyl-1,3-thiazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-methyl-1,3-thiazolidine-2-thione?
The IUPAC name of 4-hydroxy-3-methyl-1,3-thiazolidine-2-thione (CID 130122041) is 4-hydroxy-3-methyl-1,3-thiazolidine-2-thione.
What is the SMILES notation for 4-hydroxy-3-methyl-1,3-thiazolidine-2-thione?
The canonical SMILES for 4-hydroxy-3-methyl-1,3-thiazolidine-2-thione is CN1C(=S)SCC1O.
What is the InChIKey of 4-hydroxy-3-methyl-1,3-thiazolidine-2-thione?
The InChIKey is LBRPRFBIIKBDEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NOS2/c1-5-3(6)2-8-4(5)7/h3,6H,2H2,1H3.
What are the key properties of 4-hydroxy-3-methyl-1,3-thiazolidine-2-thione?
4-hydroxy-3-methyl-1,3-thiazolidine-2-thione has a molecular weight of 149.24 g/mol, XLogP of 0.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-methyl-1,3-thiazolidine-2-thione is sourced from PubChem (CID 130122041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).