About (E)-non-4-en-2,6-diyne-1,8-diol
(E)-non-4-en-2,6-diyne-1,8-diol (PubChem CID 130123356) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is (E)-non-4-en-2,6-diyne-1,8-diol.
Molecular Properties
| Compound Name | (E)-non-4-en-2,6-diyne-1,8-diol |
| PubChem CID | 130123356 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | (E)-non-4-en-2,6-diyne-1,8-diol |
| SMILES | CC(O)C#C/C=C/C#CCO |
| InChI | InChI=1S/C9H10O2/c1-9(11)7-5-3-2-4-6-8-10/h2-3,9-11H,8H2,1H3/b3-2+ |
| InChIKey | LLIDEKKNGHFVKM-NSCUHMNNSA-N |
| XLogP | -0.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-non-4-en-2,6-diyne-1,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-non-4-en-2,6-diyne-1,8-diol?
The IUPAC name of (E)-non-4-en-2,6-diyne-1,8-diol (CID 130123356) is (E)-non-4-en-2,6-diyne-1,8-diol.
What is the SMILES notation for (E)-non-4-en-2,6-diyne-1,8-diol?
The canonical SMILES for (E)-non-4-en-2,6-diyne-1,8-diol is CC(O)C#C/C=C/C#CCO.
What is the InChIKey of (E)-non-4-en-2,6-diyne-1,8-diol?
The InChIKey is LLIDEKKNGHFVKM-NSCUHMNNSA-N. The full InChI is InChI=1S/C9H10O2/c1-9(11)7-5-3-2-4-6-8-10/h2-3,9-11H,8H2,1H3/b3-2+.
What are the key properties of (E)-non-4-en-2,6-diyne-1,8-diol?
(E)-non-4-en-2,6-diyne-1,8-diol has a molecular weight of 150.18 g/mol, XLogP of -0.08, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-non-4-en-2,6-diyne-1,8-diol is sourced from PubChem (CID 130123356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).