C13H22O — CID 130125153
4-cyclopentyl-2,2-dimethylhexa-4,5-dien-3-ol (PubChem CID 130125153) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 4-cyclopentyl-2,2-dimethylhexa-4,5-dien-3-ol.
| Compound Name | 4-cyclopentyl-2,2-dimethylhexa-4,5-dien-3-ol |
|---|---|
| PubChem CID | 130125153 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 4-cyclopentyl-2,2-dimethylhexa-4,5-dien-3-ol |
| SMILES | C=C=C(C1CCCC1)C(O)C(C)(C)C |
| InChI | InChI=1S/C13H22O/c1-5-11(10-8-6-7-9-10)12(14)13(2,3)4/h10,12,14H,1,6-9H2,2-4H3 |
| InChIKey | XUOKKXULZGCIIR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |