About 4-(dimethylamino)oxane-2,3-diol
4-(dimethylamino)oxane-2,3-diol (PubChem CID 130125809) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is 4-(dimethylamino)oxane-2,3-diol.
Molecular Properties
| Compound Name | 4-(dimethylamino)oxane-2,3-diol |
| PubChem CID | 130125809 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 4-(dimethylamino)oxane-2,3-diol |
| SMILES | CN(C)C1CCOC(O)C1O |
| InChI | InChI=1S/C7H15NO3/c1-8(2)5-3-4-11-7(10)6(5)9/h5-7,9-10H,3-4H2,1-2H3 |
| InChIKey | UGNCKMNOQZJBMB-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(dimethylamino)oxane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)oxane-2,3-diol?
The IUPAC name of 4-(dimethylamino)oxane-2,3-diol (CID 130125809) is 4-(dimethylamino)oxane-2,3-diol.
What is the SMILES notation for 4-(dimethylamino)oxane-2,3-diol?
The canonical SMILES for 4-(dimethylamino)oxane-2,3-diol is CN(C)C1CCOC(O)C1O.
What is the InChIKey of 4-(dimethylamino)oxane-2,3-diol?
The InChIKey is UGNCKMNOQZJBMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO3/c1-8(2)5-3-4-11-7(10)6(5)9/h5-7,9-10H,3-4H2,1-2H3.
What are the key properties of 4-(dimethylamino)oxane-2,3-diol?
4-(dimethylamino)oxane-2,3-diol has a molecular weight of 161.20 g/mol, XLogP of -0.98, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)oxane-2,3-diol is sourced from PubChem (CID 130125809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).