About 4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol
4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol (PubChem CID 130126509) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol.
Molecular Properties
| Compound Name | 4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol |
| PubChem CID | 130126509 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol |
| SMILES | OCC1CCC2=C(C1)C1CCC2C1 |
| InChI | InChI=1S/C12H18O/c13-7-8-1-4-11-9-2-3-10(6-9)12(11)5-8/h8-10,13H,1-7H2 |
| InChIKey | HNUQWBSSSODPKV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol?
The IUPAC name of 4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol (CID 130126509) is 4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol.
What is the SMILES notation for 4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol?
The canonical SMILES for 4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol is OCC1CCC2=C(C1)C1CCC2C1.
What is the InChIKey of 4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol?
The InChIKey is HNUQWBSSSODPKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c13-7-8-1-4-11-9-2-3-10(6-9)12(11)5-8/h8-10,13H,1-7H2.
What are the key properties of 4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol?
4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol has a molecular weight of 178.27 g/mol, XLogP of 2.51, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tricyclo[6.2.1.02,7]undec-2(7)-enylmethanol is sourced from PubChem (CID 130126509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).