C13H16O — CID 130126841
2-(3,3-dimethyl-2-phenylcyclopropen-1-yl)ethanol (PubChem CID 130126841) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2-phenylcyclopropen-1-yl)ethanol.
| Compound Name | 2-(3,3-dimethyl-2-phenylcyclopropen-1-yl)ethanol |
|---|---|
| PubChem CID | 130126841 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-(3,3-dimethyl-2-phenylcyclopropen-1-yl)ethanol |
| SMILES | CC1(C)C(CCO)=C1c1ccccc1 |
| InChI | InChI=1S/C13H16O/c1-13(2)11(8-9-14)12(13)10-6-4-3-5-7-10/h3-7,14H,8-9H2,1-2H3 |
| InChIKey | CBUANKGXNSCQAI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |