C9H16O2 — CID 130127294
[3-(hydroxymethyl)-2,2-dimethylcyclopent-3-en-1-yl]methanol (PubChem CID 130127294) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is [3-(hydroxymethyl)-2,2-dimethylcyclopent-3-en-1-yl]methanol.
| Compound Name | [3-(hydroxymethyl)-2,2-dimethylcyclopent-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 130127294 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | [3-(hydroxymethyl)-2,2-dimethylcyclopent-3-en-1-yl]methanol |
| SMILES | CC1(C)C(CO)=CCC1CO |
| InChI | InChI=1S/C9H16O2/c1-9(2)7(5-10)3-4-8(9)6-11/h3,8,10-11H,4-6H2,1-2H3 |
| InChIKey | DMLGHBDLIROHFE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|