C26H26N4O3S — CID 1301285
2-methyl-4-[4-methyl-3-(4-phenylpiperazin-1-yl)sulfonylphenyl]phthalazin-1-one (PubChem CID 1301285) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is 2-methyl-4-[4-methyl-3-(4-phenylpiperazin-1-yl)sulfonylphenyl]phthalazin-1-one.
| Compound Name | 2-methyl-4-[4-methyl-3-(4-phenylpiperazin-1-yl)sulfonylphenyl]phthalazin-1-one |
|---|---|
| PubChem CID | 1301285 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-methyl-4-[4-methyl-3-(4-phenylpiperazin-1-yl)sulfonylphenyl]phthalazin-1-one |
| SMILES | Cc1ccc(-c2nn(C)c(=O)c3ccccc23)cc1S(=O)(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H26N4O3S/c1-19-12-13-20(25-22-10-6-7-11-23(22)26(31)28(2)27-25)18-24(19)34(32,33)30-16-14-29(15-17-30)21-8-4-3-5-9-21/h3-13,18H,14-17H2,1-2H3 |
| InChIKey | CTJGSLRQIYINFM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |