About 4-fluoropent-4-en-1-ol
4-fluoropent-4-en-1-ol (PubChem CID 130128533) has the molecular formula C5H9FO
and a molecular weight of 104.12 g/mol. Its IUPAC name is 4-fluoropent-4-en-1-ol.
Molecular Properties
| Compound Name | 4-fluoropent-4-en-1-ol |
| PubChem CID | 130128533 |
| Molecular Formula | C5H9FO |
| Molecular Weight | 104.12 g/mol |
| Exact Mass | 104.06 |
| IUPAC Name | 4-fluoropent-4-en-1-ol |
| SMILES | C=C(F)CCCO |
| InChI | InChI=1S/C5H9FO/c1-5(6)3-2-4-7/h7H,1-4H2 |
| InChIKey | HWFJNIJJKRTRJM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.12 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoropent-4-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoropent-4-en-1-ol?
The IUPAC name of 4-fluoropent-4-en-1-ol (CID 130128533) is 4-fluoropent-4-en-1-ol.
What is the SMILES notation for 4-fluoropent-4-en-1-ol?
The canonical SMILES for 4-fluoropent-4-en-1-ol is C=C(F)CCCO.
What is the InChIKey of 4-fluoropent-4-en-1-ol?
The InChIKey is HWFJNIJJKRTRJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FO/c1-5(6)3-2-4-7/h7H,1-4H2.
What are the key properties of 4-fluoropent-4-en-1-ol?
4-fluoropent-4-en-1-ol has a molecular weight of 104.12 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoropent-4-en-1-ol is sourced from PubChem (CID 130128533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).