About 5-bromohexa-1,5-dien-3-ol
5-bromohexa-1,5-dien-3-ol (PubChem CID 130128534) has the molecular formula C6H9BrO
and a molecular weight of 177.04 g/mol. Its IUPAC name is 5-bromohexa-1,5-dien-3-ol.
Molecular Properties
| Compound Name | 5-bromohexa-1,5-dien-3-ol |
| PubChem CID | 130128534 |
| Molecular Formula | C6H9BrO |
| Molecular Weight | 177.04 g/mol |
| Exact Mass | 175.98 |
| IUPAC Name | 5-bromohexa-1,5-dien-3-ol |
| SMILES | C=CC(O)CC(=C)Br |
| InChI | InChI=1S/C6H9BrO/c1-3-6(8)4-5(2)7/h3,6,8H,1-2,4H2 |
| InChIKey | BZLLAUGXQNOVRY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.04 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-bromohexa-1,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromohexa-1,5-dien-3-ol?
The IUPAC name of 5-bromohexa-1,5-dien-3-ol (CID 130128534) is 5-bromohexa-1,5-dien-3-ol.
What is the SMILES notation for 5-bromohexa-1,5-dien-3-ol?
The canonical SMILES for 5-bromohexa-1,5-dien-3-ol is C=CC(O)CC(=C)Br.
What is the InChIKey of 5-bromohexa-1,5-dien-3-ol?
The InChIKey is BZLLAUGXQNOVRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrO/c1-3-6(8)4-5(2)7/h3,6,8H,1-2,4H2.
What are the key properties of 5-bromohexa-1,5-dien-3-ol?
5-bromohexa-1,5-dien-3-ol has a molecular weight of 177.04 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromohexa-1,5-dien-3-ol is sourced from PubChem (CID 130128534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).