About 2-hydroxybut-3-enyl but-2-ynoate
2-hydroxybut-3-enyl but-2-ynoate (PubChem CID 130129122) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 2-hydroxybut-3-enyl but-2-ynoate.
Molecular Properties
| Compound Name | 2-hydroxybut-3-enyl but-2-ynoate |
| PubChem CID | 130129122 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-hydroxybut-3-enyl but-2-ynoate |
| SMILES | C=CC(O)COC(=O)C#CC |
| InChI | InChI=1S/C8H10O3/c1-3-5-8(10)11-6-7(9)4-2/h4,7,9H,2,6H2,1H3 |
| InChIKey | HCWAYEYQPNERCL-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybut-3-enyl but-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybut-3-enyl but-2-ynoate?
The IUPAC name of 2-hydroxybut-3-enyl but-2-ynoate (CID 130129122) is 2-hydroxybut-3-enyl but-2-ynoate.
What is the SMILES notation for 2-hydroxybut-3-enyl but-2-ynoate?
The canonical SMILES for 2-hydroxybut-3-enyl but-2-ynoate is C=CC(O)COC(=O)C#CC.
What is the InChIKey of 2-hydroxybut-3-enyl but-2-ynoate?
The InChIKey is HCWAYEYQPNERCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-3-5-8(10)11-6-7(9)4-2/h4,7,9H,2,6H2,1H3.
What are the key properties of 2-hydroxybut-3-enyl but-2-ynoate?
2-hydroxybut-3-enyl but-2-ynoate has a molecular weight of 154.16 g/mol, XLogP of 0.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybut-3-enyl but-2-ynoate is sourced from PubChem (CID 130129122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).