C11H10O2 — CID 130130423
11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-4-ylmethanol (PubChem CID 130130423) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-4-ylmethanol.
| Compound Name | 11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-4-ylmethanol |
|---|---|
| PubChem CID | 130130423 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-4-ylmethanol |
| SMILES | OCc1ccc2c(c1)C1C=CC2O1 |
| InChI | InChI=1S/C11H10O2/c12-6-7-1-2-8-9(5-7)11-4-3-10(8)13-11/h1-5,10-12H,6H2 |
| InChIKey | DXZDPAAFTVULEU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|