C9H10O2 — CID 13013062
6-methyl-2,3-dihydro-1-benzofuran-3-ol (PubChem CID 13013062) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 6-methyl-2,3-dihydro-1-benzofuran-3-ol.
| Compound Name | 6-methyl-2,3-dihydro-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 13013062 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 6-methyl-2,3-dihydro-1-benzofuran-3-ol |
| SMILES | Cc1ccc2c(c1)OCC2O |
| InChI | InChI=1S/C9H10O2/c1-6-2-3-7-8(10)5-11-9(7)4-6/h2-4,8,10H,5H2,1H3 |
| InChIKey | LWTQPIQKZIOJGK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |