About 2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol
2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol (PubChem CID 13013063) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol.
Molecular Properties
| Compound Name | 2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol |
| PubChem CID | 13013063 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol |
| SMILES | Cc1ccc2c(c1)OC(C)C2O |
| InChI | InChI=1S/C10H12O2/c1-6-3-4-8-9(5-6)12-7(2)10(8)11/h3-5,7,10-11H,1-2H3 |
| InChIKey | XLHAVLYJVZOCEE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol?
The IUPAC name of 2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol (CID 13013063) is 2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol.
What is the SMILES notation for 2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol?
The canonical SMILES for 2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol is Cc1ccc2c(c1)OC(C)C2O.
What is the InChIKey of 2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol?
The InChIKey is XLHAVLYJVZOCEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-6-3-4-8-9(5-6)12-7(2)10(8)11/h3-5,7,10-11H,1-2H3.
What are the key properties of 2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol?
2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol has a molecular weight of 164.20 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-2,3-dihydro-1-benzofuran-3-ol is sourced from PubChem (CID 13013063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).