C23H19N5O2 — CID 13013090
N-[4-(4-methoxyanilino)-6-phenyl-1,3,5-triazin-2-yl]benzamide (PubChem CID 13013090) has the molecular formula C23H19N5O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is N-[4-(4-methoxyanilino)-6-phenyl-1,3,5-triazin-2-yl]benzamide.
| Compound Name | N-[4-(4-methoxyanilino)-6-phenyl-1,3,5-triazin-2-yl]benzamide |
|---|---|
| PubChem CID | 13013090 |
| Molecular Formula | C23H19N5O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[4-(4-methoxyanilino)-6-phenyl-1,3,5-triazin-2-yl]benzamide |
| SMILES | COc1ccc(Nc2nc(NC(=O)c3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H19N5O2/c1-30-19-14-12-18(13-15-19)24-22-25-20(16-8-4-2-5-9-16)26-23(28-22)27-21(29)17-10-6-3-7-11-17/h2-15H,1H3,(H2,24,25,26,27,28,29) |
| InChIKey | CXBQUXZUEDDJAP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |