C10H12N2O2 — CID 130131058
2-amino-6-hydroxy-5,6,7,8-tetrahydroquinoline-3-carbaldehyde (PubChem CID 130131058) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-amino-6-hydroxy-5,6,7,8-tetrahydroquinoline-3-carbaldehyde.
| Compound Name | 2-amino-6-hydroxy-5,6,7,8-tetrahydroquinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 130131058 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-amino-6-hydroxy-5,6,7,8-tetrahydroquinoline-3-carbaldehyde |
| SMILES | Nc1nc2c(cc1C=O)CC(O)CC2 |
| InChI | InChI=1S/C10H12N2O2/c11-10-7(5-13)3-6-4-8(14)1-2-9(6)12-10/h3,5,8,14H,1-2,4H2,(H2,11,12) |
| InChIKey | GLEOFEYSHFSHNQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|