About 3-iodo-6,8-dimethoxychromen-4-one
3-iodo-6,8-dimethoxychromen-4-one (PubChem CID 130131544) has the molecular formula C11H9IO4
and a molecular weight of 332.09 g/mol. Its IUPAC name is 3-iodo-6,8-dimethoxychromen-4-one.
Molecular Properties
| Compound Name | 3-iodo-6,8-dimethoxychromen-4-one |
| PubChem CID | 130131544 |
| Molecular Formula | C11H9IO4 |
| Molecular Weight | 332.09 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 3-iodo-6,8-dimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2occ(I)c(=O)c2c1 |
| InChI | InChI=1S/C11H9IO4/c1-14-6-3-7-10(13)8(12)5-16-11(7)9(4-6)15-2/h3-5H,1-2H3 |
| InChIKey | CVWJYAKVANMGMI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.09 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-6,8-dimethoxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-6,8-dimethoxychromen-4-one?
The IUPAC name of 3-iodo-6,8-dimethoxychromen-4-one (CID 130131544) is 3-iodo-6,8-dimethoxychromen-4-one.
What is the SMILES notation for 3-iodo-6,8-dimethoxychromen-4-one?
The canonical SMILES for 3-iodo-6,8-dimethoxychromen-4-one is COc1cc(OC)c2occ(I)c(=O)c2c1.
What is the InChIKey of 3-iodo-6,8-dimethoxychromen-4-one?
The InChIKey is CVWJYAKVANMGMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9IO4/c1-14-6-3-7-10(13)8(12)5-16-11(7)9(4-6)15-2/h3-5H,1-2H3.
What are the key properties of 3-iodo-6,8-dimethoxychromen-4-one?
3-iodo-6,8-dimethoxychromen-4-one has a molecular weight of 332.09 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-6,8-dimethoxychromen-4-one is sourced from PubChem (CID 130131544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).