About 2,5-dibromoquinazoline
2,5-dibromoquinazoline (PubChem CID 130132273) has the molecular formula C8H4Br2N2
and a molecular weight of 287.94 g/mol. Its IUPAC name is 2,5-dibromoquinazoline.
Molecular Properties
| Compound Name | 2,5-dibromoquinazoline |
| PubChem CID | 130132273 |
| Molecular Formula | C8H4Br2N2 |
| Molecular Weight | 287.94 g/mol |
| Exact Mass | 285.87 |
| IUPAC Name | 2,5-dibromoquinazoline |
| SMILES | Brc1ncc2c(Br)cccc2n1 |
| InChI | InChI=1S/C8H4Br2N2/c9-6-2-1-3-7-5(6)4-11-8(10)12-7/h1-4H |
| InChIKey | WLKBPDWXZISDDW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.94 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dibromoquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibromoquinazoline?
The IUPAC name of 2,5-dibromoquinazoline (CID 130132273) is 2,5-dibromoquinazoline.
What is the SMILES notation for 2,5-dibromoquinazoline?
The canonical SMILES for 2,5-dibromoquinazoline is Brc1ncc2c(Br)cccc2n1.
What is the InChIKey of 2,5-dibromoquinazoline?
The InChIKey is WLKBPDWXZISDDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Br2N2/c9-6-2-1-3-7-5(6)4-11-8(10)12-7/h1-4H.
What are the key properties of 2,5-dibromoquinazoline?
2,5-dibromoquinazoline has a molecular weight of 287.94 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromoquinazoline is sourced from PubChem (CID 130132273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).