About 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile
2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile (PubChem CID 130132662) has the molecular formula C6H6N2OS
and a molecular weight of 154.19 g/mol. Its IUPAC name is 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile |
| PubChem CID | 130132662 |
| Molecular Formula | C6H6N2OS |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile |
| SMILES | Cc1cc(C(O)C#N)sn1 |
| InChI | InChI=1S/C6H6N2OS/c1-4-2-6(10-8-4)5(9)3-7/h2,5,9H,1H3 |
| InChIKey | GJLHUQAPOUYOEY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile?
The IUPAC name of 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile (CID 130132662) is 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile.
What is the SMILES notation for 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile?
The canonical SMILES for 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile is Cc1cc(C(O)C#N)sn1.
What is the InChIKey of 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile?
The InChIKey is GJLHUQAPOUYOEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2OS/c1-4-2-6(10-8-4)5(9)3-7/h2,5,9H,1H3.
What are the key properties of 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile?
2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile has a molecular weight of 154.19 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetonitrile is sourced from PubChem (CID 130132662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).