About 7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine
7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 130133273) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 130133273 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | C#Cc1ccc2c(c1)OCCN2C |
| InChI | InChI=1S/C11H11NO/c1-3-9-4-5-10-11(8-9)13-7-6-12(10)2/h1,4-5,8H,6-7H2,2H3 |
| InChIKey | AQKCMMLRBXFSAX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine (CID 130133273) is 7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine is C#Cc1ccc2c(c1)OCCN2C.
What is the InChIKey of 7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine?
The InChIKey is AQKCMMLRBXFSAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-3-9-4-5-10-11(8-9)13-7-6-12(10)2/h1,4-5,8H,6-7H2,2H3.
What are the key properties of 7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine?
7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine has a molecular weight of 173.21 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethynyl-4-methyl-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 130133273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).