About 3-(trifluoromethyl)-1,2-dihydroindol-3-ol
3-(trifluoromethyl)-1,2-dihydroindol-3-ol (PubChem CID 130136128) has the molecular formula C9H8F3NO
and a molecular weight of 203.16 g/mol. Its IUPAC name is 3-(trifluoromethyl)-1,2-dihydroindol-3-ol.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)-1,2-dihydroindol-3-ol |
| PubChem CID | 130136128 |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 3-(trifluoromethyl)-1,2-dihydroindol-3-ol |
| SMILES | OC1(C(F)(F)F)CNc2ccccc21 |
| InChI | InChI=1S/C9H8F3NO/c10-9(11,12)8(14)5-13-7-4-2-1-3-6(7)8/h1-4,13-14H,5H2 |
| InChIKey | OETSYRWNRDAGEJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(trifluoromethyl)-1,2-dihydroindol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)-1,2-dihydroindol-3-ol?
The IUPAC name of 3-(trifluoromethyl)-1,2-dihydroindol-3-ol (CID 130136128) is 3-(trifluoromethyl)-1,2-dihydroindol-3-ol.
What is the SMILES notation for 3-(trifluoromethyl)-1,2-dihydroindol-3-ol?
The canonical SMILES for 3-(trifluoromethyl)-1,2-dihydroindol-3-ol is OC1(C(F)(F)F)CNc2ccccc21.
What is the InChIKey of 3-(trifluoromethyl)-1,2-dihydroindol-3-ol?
The InChIKey is OETSYRWNRDAGEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3NO/c10-9(11,12)8(14)5-13-7-4-2-1-3-6(7)8/h1-4,13-14H,5H2.
What are the key properties of 3-(trifluoromethyl)-1,2-dihydroindol-3-ol?
3-(trifluoromethyl)-1,2-dihydroindol-3-ol has a molecular weight of 203.16 g/mol, XLogP of 1.86, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)-1,2-dihydroindol-3-ol is sourced from PubChem (CID 130136128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).