C10H17NO2 — CID 130136372
3-hydroxy-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one (PubChem CID 130136372) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-hydroxy-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one.
| Compound Name | 3-hydroxy-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 130136372 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3-hydroxy-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one |
| SMILES | CC1NC2CCCCC2C(=O)C1O |
| InChI | InChI=1S/C10H17NO2/c1-6-9(12)10(13)7-4-2-3-5-8(7)11-6/h6-9,11-12H,2-5H2,1H3 |
| InChIKey | OUZXJIYUEPCHDG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |